C16H18N4O2 — CID 163311098
(1R,7S)-5-(3-methoxyphenyl)-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one (PubChem CID 163311098) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (1R,7S)-5-(3-methoxyphenyl)-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one.
| Compound Name | (1R,7S)-5-(3-methoxyphenyl)-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
|---|---|
| PubChem CID | 163311098 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (1R,7S)-5-(3-methoxyphenyl)-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
| SMILES | COc1cccc(-c2nnc3n2[C@@H](C)C(=O)N2CCC[C@H]32)c1 |
| InChI | InChI=1S/C16H18N4O2/c1-10-16(21)19-8-4-7-13(19)15-18-17-14(20(10)15)11-5-3-6-12(9-11)22-2/h3,5-6,9-10,13H,4,7-8H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | SPTDIVZQUYXNTF-GXFFZTMASA-N |
| XLogP | 2.19 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |