C14H15N5O — CID 164692146
(1S,7S)-7-methyl-5-pyridin-3-yl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one (PubChem CID 164692146) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is (1S,7S)-7-methyl-5-pyridin-3-yl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one.
| Compound Name | (1S,7S)-7-methyl-5-pyridin-3-yl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
|---|---|
| PubChem CID | 164692146 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (1S,7S)-7-methyl-5-pyridin-3-yl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
| SMILES | C[C@H]1C(=O)N2CCC[C@H]2c2nnc(-c3cccnc3)n21 |
| InChI | InChI=1S/C14H15N5O/c1-9-14(20)18-7-3-5-11(18)13-17-16-12(19(9)13)10-4-2-6-15-8-10/h2,4,6,8-9,11H,3,5,7H2,1H3/t9-,11-/m0/s1 |
| InChIKey | HHIDVTDNPSKDIH-ONGXEEELSA-N |
| XLogP | 1.58 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |