C15H15FN4O — CID 163305333
(1R,7S)-5-(4-fluorophenyl)-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one (PubChem CID 163305333) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is (1R,7S)-5-(4-fluorophenyl)-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one.
| Compound Name | (1R,7S)-5-(4-fluorophenyl)-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
|---|---|
| PubChem CID | 163305333 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (1R,7S)-5-(4-fluorophenyl)-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
| SMILES | C[C@H]1C(=O)N2CCC[C@@H]2c2nnc(-c3ccc(F)cc3)n21 |
| InChI | InChI=1S/C15H15FN4O/c1-9-15(21)19-8-2-3-12(19)14-18-17-13(20(9)14)10-4-6-11(16)7-5-10/h4-7,9,12H,2-3,8H2,1H3/t9-,12+/m0/s1 |
| InChIKey | OZQBDPVHBPYRJH-JOYOIKCWSA-N |
| XLogP | 2.32 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |