C13H22N4O — CID 117155865
4-[2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]morpholine (PubChem CID 117155865) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-[2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]morpholine.
| Compound Name | 4-[2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 117155865 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-[2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]morpholine |
| SMILES | CC1CCCc2nc(CCN3CCOCC3)nn21 |
| InChI | InChI=1S/C13H22N4O/c1-11-3-2-4-13-14-12(15-17(11)13)5-6-16-7-9-18-10-8-16/h11H,2-10H2,1H3 |
| InChIKey | OYLXYLSLYDRSNA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |