C12H19N3O2 — CID 117157947
2-(oxan-2-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol (PubChem CID 117157947) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(oxan-2-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol.
| Compound Name | 2-(oxan-2-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
|---|---|
| PubChem CID | 117157947 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-(oxan-2-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
| SMILES | OC1CCCn2nc(CC3CCCCO3)nc21 |
| InChI | InChI=1S/C12H19N3O2/c16-10-5-3-6-15-12(10)13-11(14-15)8-9-4-1-2-7-17-9/h9-10,16H,1-8H2 |
| InChIKey | MYTKMJILXRZWSA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |