C11H13N3O2 — CID 117158060
2-(5-methylfuran-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol (PubChem CID 117158060) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol.
| Compound Name | 2-(5-methylfuran-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
|---|---|
| PubChem CID | 117158060 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
| SMILES | Cc1ccc(-c2nc3n(n2)CCCC3O)o1 |
| InChI | InChI=1S/C11H13N3O2/c1-7-4-5-9(16-7)10-12-11-8(15)3-2-6-14(11)13-10/h4-5,8,15H,2-3,6H2,1H3 |
| InChIKey | ISZDHXSVRJSPSB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |