C14H19N3O2 — CID 117160038
3-(3-methoxypropyl)-2-(oxolan-3-yl)imidazo[4,5-b]pyridine (PubChem CID 117160038) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-2-(oxolan-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(3-methoxypropyl)-2-(oxolan-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117160038 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(3-methoxypropyl)-2-(oxolan-3-yl)imidazo[4,5-b]pyridine |
| SMILES | COCCCn1c(C2CCOC2)nc2cccnc21 |
| InChI | InChI=1S/C14H19N3O2/c1-18-8-3-7-17-13(11-5-9-19-10-11)16-12-4-2-6-15-14(12)17/h2,4,6,11H,3,5,7-10H2,1H3 |
| InChIKey | RJSRVSANNLCUEI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|