C15H28O4 — CID 11716010
(1S,2S)-1-[(4R,5R)-2,2-dimethyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxolan-4-yl]-2-ethylpropane-1,3-diol (PubChem CID 11716010) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is (1S,2S)-1-[(4R,5R)-2,2-dimethyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxolan-4-yl]-2-ethylpropane-1,3-diol.
| Compound Name | (1S,2S)-1-[(4R,5R)-2,2-dimethyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxolan-4-yl]-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 11716010 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (1S,2S)-1-[(4R,5R)-2,2-dimethyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxolan-4-yl]-2-ethylpropane-1,3-diol |
| SMILES | CC[C@@H](CO)[C@H](O)[C@H]1OC(C)(C)O[C@@H]1/C=C/C(C)C |
| InChI | InChI=1S/C15H28O4/c1-6-11(9-16)13(17)14-12(8-7-10(2)3)18-15(4,5)19-14/h7-8,10-14,16-17H,6,9H2,1-5H3/b8-7+/t11-,12+,13-,14-/m0/s1 |
| InChIKey | SVNRGHKWTWEZHK-XBARHJEHSA-N |
| XLogP | 2.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|