C17H24N4S — CID 117162220
3-(1-ethylpiperidin-4-yl)-2-(thiolan-2-yl)imidazo[4,5-b]pyridine (PubChem CID 117162220) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 3-(1-ethylpiperidin-4-yl)-2-(thiolan-2-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(1-ethylpiperidin-4-yl)-2-(thiolan-2-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117162220 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3-(1-ethylpiperidin-4-yl)-2-(thiolan-2-yl)imidazo[4,5-b]pyridine |
| SMILES | CCN1CCC(n2c(C3CCCS3)nc3cccnc32)CC1 |
| InChI | InChI=1S/C17H24N4S/c1-2-20-10-7-13(8-11-20)21-16-14(5-3-9-18-16)19-17(21)15-6-4-12-22-15/h3,5,9,13,15H,2,4,6-8,10-12H2,1H3 |
| InChIKey | LFDZCBGXPIGPRN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |