C17H17N3S — CID 117162624
3-(2-methylphenyl)-2-(thiolan-2-yl)imidazo[4,5-b]pyridine (PubChem CID 117162624) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is 3-(2-methylphenyl)-2-(thiolan-2-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(2-methylphenyl)-2-(thiolan-2-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117162624 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-(2-methylphenyl)-2-(thiolan-2-yl)imidazo[4,5-b]pyridine |
| SMILES | Cc1ccccc1-n1c(C2CCCS2)nc2cccnc21 |
| InChI | InChI=1S/C17H17N3S/c1-12-6-2-3-8-14(12)20-16-13(7-4-10-18-16)19-17(20)15-9-5-11-21-15/h2-4,6-8,10,15H,5,9,11H2,1H3 |
| InChIKey | HWKPHKZSCOIUTI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |