C17H17N3OS — CID 117163056
3-[2-(thian-2-yl)imidazo[4,5-b]pyridin-3-yl]phenol (PubChem CID 117163056) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-[2-(thian-2-yl)imidazo[4,5-b]pyridin-3-yl]phenol.
| Compound Name | 3-[2-(thian-2-yl)imidazo[4,5-b]pyridin-3-yl]phenol |
|---|---|
| PubChem CID | 117163056 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[2-(thian-2-yl)imidazo[4,5-b]pyridin-3-yl]phenol |
| SMILES | Oc1cccc(-n2c(C3CCCCS3)nc3cccnc32)c1 |
| InChI | InChI=1S/C17H17N3OS/c21-13-6-3-5-12(11-13)20-16-14(7-4-9-18-16)19-17(20)15-8-1-2-10-22-15/h3-7,9,11,15,21H,1-2,8,10H2 |
| InChIKey | CZQFAPCVGHMXJG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |