C17H25N5 — CID 117162893
3-(1-methylpiperidin-2-yl)-2-piperidin-2-ylimidazo[4,5-b]pyridine (PubChem CID 117162893) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 3-(1-methylpiperidin-2-yl)-2-piperidin-2-ylimidazo[4,5-b]pyridine.
| Compound Name | 3-(1-methylpiperidin-2-yl)-2-piperidin-2-ylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117162893 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 3-(1-methylpiperidin-2-yl)-2-piperidin-2-ylimidazo[4,5-b]pyridine |
| SMILES | CN1CCCCC1n1c(C2CCCCN2)nc2cccnc21 |
| InChI | InChI=1S/C17H25N5/c1-21-12-5-3-9-15(21)22-16-14(8-6-11-19-16)20-17(22)13-7-2-4-10-18-13/h6,8,11,13,15,18H,2-5,7,9-10,12H2,1H3 |
| InChIKey | WOWUCPLIRHNUFY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |