C15H15ClN4S — CID 117164334
2-(5-chlorothiophen-2-yl)-3-piperidin-2-ylimidazo[4,5-b]pyridine (PubChem CID 117164334) has the molecular formula C15H15ClN4S and a molecular weight of 318.83 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-3-piperidin-2-ylimidazo[4,5-b]pyridine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-3-piperidin-2-ylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117164334 |
| Molecular Formula | C15H15ClN4S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-3-piperidin-2-ylimidazo[4,5-b]pyridine |
| SMILES | Clc1ccc(-c2nc3cccnc3n2C2CCCCN2)s1 |
| InChI | InChI=1S/C15H15ClN4S/c16-12-7-6-11(21-12)15-19-10-4-3-9-18-14(10)20(15)13-5-1-2-8-17-13/h3-4,6-7,9,13,17H,1-2,5,8H2 |
| InChIKey | CAPNJCVKAYIABT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |