C17H24N4S — CID 117163688
3-piperidin-2-yl-2-(thian-2-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117163688) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 3-piperidin-2-yl-2-(thian-2-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-piperidin-2-yl-2-(thian-2-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117163688 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3-piperidin-2-yl-2-(thian-2-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nc(CC1CCCCS1)n2C1CCCCN1 |
| InChI | InChI=1S/C17H24N4S/c1-3-9-18-15(8-1)21-16(12-13-6-2-4-11-22-13)20-14-7-5-10-19-17(14)21/h5,7,10,13,15,18H,1-4,6,8-9,11-12H2 |
| InChIKey | GVXLLWCKXZOWIU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |