C17H18N4S — CID 117163850
3-pyridin-4-yl-2-(thian-2-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117163850) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 3-pyridin-4-yl-2-(thian-2-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-pyridin-4-yl-2-(thian-2-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117163850 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3-pyridin-4-yl-2-(thian-2-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nc(CC1CCCCS1)n2-c1ccncc1 |
| InChI | InChI=1S/C17H18N4S/c1-2-11-22-14(4-1)12-16-20-15-5-3-8-19-17(15)21(16)13-6-9-18-10-7-13/h3,5-10,14H,1-2,4,11-12H2 |
| InChIKey | KMCAYSUSBJSZNT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |