C15H15N3S2 — CID 117164349
3-(thiolan-2-ylmethyl)-2-thiophen-2-ylimidazo[4,5-b]pyridine (PubChem CID 117164349) has the molecular formula C15H15N3S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 3-(thiolan-2-ylmethyl)-2-thiophen-2-ylimidazo[4,5-b]pyridine.
| Compound Name | 3-(thiolan-2-ylmethyl)-2-thiophen-2-ylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117164349 |
| Molecular Formula | C15H15N3S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 3-(thiolan-2-ylmethyl)-2-thiophen-2-ylimidazo[4,5-b]pyridine |
| SMILES | c1csc(-c2nc3cccnc3n2CC2CCCS2)c1 |
| InChI | InChI=1S/C15H15N3S2/c1-5-12-14(16-7-1)18(10-11-4-2-8-19-11)15(17-12)13-6-3-9-20-13/h1,3,5-7,9,11H,2,4,8,10H2 |
| InChIKey | BIXMLENZOLVVDI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |