C16H21N3S2 — CID 117161914
2-(thian-3-yl)-3-(thiolan-2-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117161914) has the molecular formula C16H21N3S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is 2-(thian-3-yl)-3-(thiolan-2-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(thian-3-yl)-3-(thiolan-2-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117161914 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-(thian-3-yl)-3-(thiolan-2-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nc(C1CCCSC1)n2CC1CCCS1 |
| InChI | InChI=1S/C16H21N3S2/c1-6-14-16(17-7-1)19(10-13-5-3-9-21-13)15(18-14)12-4-2-8-20-11-12/h1,6-7,12-13H,2-5,8-11H2 |
| InChIKey | TWERTXSBSKNHGT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |