C16H21N3OS — CID 117161893
3-(oxan-2-yl)-2-(thian-3-yl)imidazo[4,5-b]pyridine (PubChem CID 117161893) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 3-(oxan-2-yl)-2-(thian-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(oxan-2-yl)-2-(thian-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117161893 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-(oxan-2-yl)-2-(thian-3-yl)imidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nc(C1CCCSC1)n2C1CCCCO1 |
| InChI | InChI=1S/C16H21N3OS/c1-2-9-20-14(7-1)19-15(12-5-4-10-21-11-12)18-13-6-3-8-17-16(13)19/h3,6,8,12,14H,1-2,4-5,7,9-11H2 |
| InChIKey | KYOREFOQWSTKGK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |