C15H19N3OS — CID 117162755
2-(oxan-2-yl)-3-(thiolan-3-yl)imidazo[4,5-b]pyridine (PubChem CID 117162755) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-(oxan-2-yl)-3-(thiolan-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(oxan-2-yl)-3-(thiolan-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117162755 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-(oxan-2-yl)-3-(thiolan-3-yl)imidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nc(C1CCCCO1)n2C1CCSC1 |
| InChI | InChI=1S/C15H19N3OS/c1-2-8-19-13(5-1)15-17-12-4-3-7-16-14(12)18(15)11-6-9-20-10-11/h3-4,7,11,13H,1-2,5-6,8-10H2 |
| InChIKey | ZJUJYQNNTOGDHP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |