C18H19N3O2 — CID 117162997
4-[[2-(oxan-2-yl)imidazo[4,5-b]pyridin-3-yl]methyl]phenol (PubChem CID 117162997) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-[[2-(oxan-2-yl)imidazo[4,5-b]pyridin-3-yl]methyl]phenol.
| Compound Name | 4-[[2-(oxan-2-yl)imidazo[4,5-b]pyridin-3-yl]methyl]phenol |
|---|---|
| PubChem CID | 117162997 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-[[2-(oxan-2-yl)imidazo[4,5-b]pyridin-3-yl]methyl]phenol |
| SMILES | Oc1ccc(Cn2c(C3CCCCO3)nc3cccnc32)cc1 |
| InChI | InChI=1S/C18H19N3O2/c22-14-8-6-13(7-9-14)12-21-17-15(4-3-10-19-17)20-18(21)16-5-1-2-11-23-16/h3-4,6-10,16,22H,1-2,5,11-12H2 |
| InChIKey | KFXCSTNXQAGOPC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |