C18H19N3O2 — CID 117163085
3-(4-methoxyphenyl)-2-(oxan-2-yl)imidazo[4,5-b]pyridine (PubChem CID 117163085) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-(oxan-2-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(4-methoxyphenyl)-2-(oxan-2-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117163085 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-(oxan-2-yl)imidazo[4,5-b]pyridine |
| SMILES | COc1ccc(-n2c(C3CCCCO3)nc3cccnc32)cc1 |
| InChI | InChI=1S/C18H19N3O2/c1-22-14-9-7-13(8-10-14)21-17-15(5-4-11-19-17)20-18(21)16-6-2-3-12-23-16/h4-5,7-11,16H,2-3,6,12H2,1H3 |
| InChIKey | FOXCKCZPVBSPDL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |