C15H15N3O2 — CID 117162710
3-(furan-2-ylmethyl)-2-(oxolan-2-yl)imidazo[4,5-b]pyridine (PubChem CID 117162710) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2-(oxolan-2-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(furan-2-ylmethyl)-2-(oxolan-2-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117162710 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2-(oxolan-2-yl)imidazo[4,5-b]pyridine |
| SMILES | c1coc(Cn2c(C3CCCO3)nc3cccnc32)c1 |
| InChI | InChI=1S/C15H15N3O2/c1-5-12-14(16-7-1)18(10-11-4-2-8-19-11)15(17-12)13-6-3-9-20-13/h1-2,4-5,7-8,13H,3,6,9-10H2 |
| InChIKey | NQNLEWQGJNAXEZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |