C13H13N3O2 — CID 117160032
2-[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]ethanol (PubChem CID 117160032) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]ethanol.
| Compound Name | 2-[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]ethanol |
|---|---|
| PubChem CID | 117160032 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]ethanol |
| SMILES | OCCc1nc2cccnc2n1Cc1ccco1 |
| InChI | InChI=1S/C13H13N3O2/c17-7-5-12-15-11-4-1-6-14-13(11)16(12)9-10-3-2-8-18-10/h1-4,6,8,17H,5,7,9H2 |
| InChIKey | ACDONEZDFKYNHO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |