C19H22N4O5 — CID 159440701
3-(furan-2-ylmethyl)-2-(piperidin-4-ylmethyl)imidazo[4,5-b]pyridine;oxalic acid (PubChem CID 159440701) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2-(piperidin-4-ylmethyl)imidazo[4,5-b]pyridine;oxalic acid.
| Compound Name | 3-(furan-2-ylmethyl)-2-(piperidin-4-ylmethyl)imidazo[4,5-b]pyridine;oxalic acid |
|---|---|
| PubChem CID | 159440701 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2-(piperidin-4-ylmethyl)imidazo[4,5-b]pyridine;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1coc(Cn2c(CC3CCNCC3)nc3cccnc32)c1 |
| InChI | InChI=1S/C17H20N4O.C2H2O4/c1-4-15-17(19-7-1)21(12-14-3-2-10-22-14)16(20-15)11-13-5-8-18-9-6-13;3-1(4)2(5)6/h1-4,7,10,13,18H,5-6,8-9,11-12H2;(H,3,4)(H,5,6) |
| InChIKey | LSDCWQYXSXFOPD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|