C21H24N4O4S — CID 157474822
(E)-but-2-enedioic acid;2-(piperidin-4-ylmethyl)-3-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 157474822) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(piperidin-4-ylmethyl)-3-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | (E)-but-2-enedioic acid;2-(piperidin-4-ylmethyl)-3-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 157474822 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(piperidin-4-ylmethyl)-3-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | O=C(O)/C=C/C(=O)O.c1csc(Cn2c(CC3CCNCC3)nc3cccnc32)c1 |
| InChI | InChI=1S/C17H20N4S.C4H4O4/c1-4-15-17(19-7-1)21(12-14-3-2-10-22-14)16(20-15)11-13-5-8-18-9-6-13;5-3(6)1-2-4(7)8/h1-4,7,10,13,18H,5-6,8-9,11-12H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BVLVGMJJXKNYSH-WLHGVMLRSA-N |
| XLogP | 2.80 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|