C17H19N3OS — CID 117164115
2-(oxan-3-ylmethyl)-3-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117164115) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-(oxan-3-ylmethyl)-3-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(oxan-3-ylmethyl)-3-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117164115 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(oxan-3-ylmethyl)-3-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | c1csc(Cn2c(CC3CCCOC3)nc3cccnc32)c1 |
| InChI | InChI=1S/C17H19N3OS/c1-6-15-17(18-7-1)20(11-14-5-3-9-22-14)16(19-15)10-13-4-2-8-21-12-13/h1,3,5-7,9,13H,2,4,8,10-12H2 |
| InChIKey | AHAJGOKEACRICI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |