C19H23N5O5 — CID 86743720
3-[(5-methylfuran-2-yl)methyl]-N-piperidin-4-ylimidazo[4,5-b]pyridin-2-amine;oxalic acid (PubChem CID 86743720) has the molecular formula C19H23N5O5 and a molecular weight of 401.42 g/mol. Its IUPAC name is 3-[(5-methylfuran-2-yl)methyl]-N-piperidin-4-ylimidazo[4,5-b]pyridin-2-amine;oxalic acid.
| Compound Name | 3-[(5-methylfuran-2-yl)methyl]-N-piperidin-4-ylimidazo[4,5-b]pyridin-2-amine;oxalic acid |
|---|---|
| PubChem CID | 86743720 |
| Molecular Formula | C19H23N5O5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-[(5-methylfuran-2-yl)methyl]-N-piperidin-4-ylimidazo[4,5-b]pyridin-2-amine;oxalic acid |
| SMILES | Cc1ccc(Cn2c(NC3CCNCC3)nc3cccnc32)o1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H21N5O.C2H2O4/c1-12-4-5-14(23-12)11-22-16-15(3-2-8-19-16)21-17(22)20-13-6-9-18-10-7-13;3-1(4)2(5)6/h2-5,8,13,18H,6-7,9-11H2,1H3,(H,20,21);(H,3,4)(H,5,6) |
| InChIKey | KLRNULGGLGVCCO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 142.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|