C44H58N8O8 — CID 67895703
bis(2-[4-[[1-[(5-methylfuran-2-yl)methyl]benzimidazol-2-yl]amino]azepan-1-yl]ethanol);oxalic acid (PubChem CID 67895703) has the molecular formula C44H58N8O8 and a molecular weight of 827.00 g/mol. Its IUPAC name is bis(2-[4-[[1-[(5-methylfuran-2-yl)methyl]benzimidazol-2-yl]amino]azepan-1-yl]ethanol);oxalic acid.
| Compound Name | bis(2-[4-[[1-[(5-methylfuran-2-yl)methyl]benzimidazol-2-yl]amino]azepan-1-yl]ethanol);oxalic acid |
|---|---|
| PubChem CID | 67895703 |
| Molecular Formula | C44H58N8O8 |
| Molecular Weight | 827.00 g/mol |
| Exact Mass | 826.44 |
| IUPAC Name | bis(2-[4-[[1-[(5-methylfuran-2-yl)methyl]benzimidazol-2-yl]amino]azepan-1-yl]ethanol);oxalic acid |
| SMILES | Cc1ccc(Cn2c(NC3CCCN(CCO)CC3)nc3ccccc32)o1.Cc1ccc(Cn2c(NC3CCCN(CCO)CC3)nc3ccccc32)o1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C21H28N4O2.C2H2O4/c2*1-16-8-9-18(27-16)15-25-20-7-3-2-6-19(20)23-21(25)22-17-5-4-11-24(12-10-17)13-14-26;3-1(4)2(5)6/h2*2-3,6-9,17,26H,4-5,10-15H2,1H3,(H,22,23);(H,3,4)(H,5,6) |
| InChIKey | URKRFIHDZGOAHX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 207.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.00 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|