C20H26N6O2S — CID 88707524
1-[2-[4-[[1-(furan-2-ylmethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-1-sulfanylurea (PubChem CID 88707524) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is 1-[2-[4-[[1-(furan-2-ylmethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-1-sulfanylurea.
| Compound Name | 1-[2-[4-[[1-(furan-2-ylmethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 88707524 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[2-[4-[[1-(furan-2-ylmethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-1-sulfanylurea |
| SMILES | NC(=O)N(S)CCN1CCC(Nc2nc3ccccc3n2Cc2ccco2)CC1 |
| InChI | InChI=1S/C20H26N6O2S/c21-19(27)26(29)12-11-24-9-7-15(8-10-24)22-20-23-17-5-1-2-6-18(17)25(20)14-16-4-3-13-28-16/h1-6,13,15,29H,7-12,14H2,(H2,21,27)(H,22,23) |
| InChIKey | BGSOHCPKFYYETO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|