C19H22N4O3 — CID 67885256
5-[[2-[(1-methylpiperidin-4-yl)amino]benzimidazol-1-yl]methyl]furan-3-carboxylic acid (PubChem CID 67885256) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[[2-[(1-methylpiperidin-4-yl)amino]benzimidazol-1-yl]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[2-[(1-methylpiperidin-4-yl)amino]benzimidazol-1-yl]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 67885256 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-[[2-[(1-methylpiperidin-4-yl)amino]benzimidazol-1-yl]methyl]furan-3-carboxylic acid |
| SMILES | CN1CCC(Nc2nc3ccccc3n2Cc2cc(C(=O)O)co2)CC1 |
| InChI | InChI=1S/C19H22N4O3/c1-22-8-6-14(7-9-22)20-19-21-16-4-2-3-5-17(16)23(19)11-15-10-13(12-26-15)18(24)25/h2-5,10,12,14H,6-9,11H2,1H3,(H,20,21)(H,24,25) |
| InChIKey | ILRCJGPKACVVNM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |