C20H28N4O6 — CID 159801214
but-2-enedioic acid;2-[[2-[(1-methylpiperidin-4-yl)amino]benzimidazol-1-yl]methoxy]ethanol (PubChem CID 159801214) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is but-2-enedioic acid;2-[[2-[(1-methylpiperidin-4-yl)amino]benzimidazol-1-yl]methoxy]ethanol.
| Compound Name | but-2-enedioic acid;2-[[2-[(1-methylpiperidin-4-yl)amino]benzimidazol-1-yl]methoxy]ethanol |
|---|---|
| PubChem CID | 159801214 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | but-2-enedioic acid;2-[[2-[(1-methylpiperidin-4-yl)amino]benzimidazol-1-yl]methoxy]ethanol |
| SMILES | CN1CCC(Nc2nc3ccccc3n2COCCO)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H24N4O2.C4H4O4/c1-19-8-6-13(7-9-19)17-16-18-14-4-2-3-5-15(14)20(16)12-22-11-10-21;5-3(6)1-2-4(7)8/h2-5,13,21H,6-12H2,1H3,(H,17,18);1-2H,(H,5,6)(H,7,8) |
| InChIKey | NJUSOPBWXLORCR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|