C16H19N7 — CID 19785321
N-piperidin-4-yl-9-(pyridin-2-ylmethyl)purin-8-amine (PubChem CID 19785321) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is N-piperidin-4-yl-9-(pyridin-2-ylmethyl)purin-8-amine.
| Compound Name | N-piperidin-4-yl-9-(pyridin-2-ylmethyl)purin-8-amine |
|---|---|
| PubChem CID | 19785321 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-piperidin-4-yl-9-(pyridin-2-ylmethyl)purin-8-amine |
| SMILES | c1ccc(Cn2c(NC3CCNCC3)nc3cncnc32)nc1 |
| InChI | InChI=1S/C16H19N7/c1-2-6-19-13(3-1)10-23-15-14(9-18-11-20-15)22-16(23)21-12-4-7-17-8-5-12/h1-3,6,9,11-12,17H,4-5,7-8,10H2,(H,21,22) |
| InChIKey | MUZFQBKVDYVBOO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |