C22H25Cl2N5 — CID 22036977
N-piperidin-4-yl-1-(quinolin-2-ylmethyl)benzimidazol-2-amine;dihydrochloride (PubChem CID 22036977) has the molecular formula C22H25Cl2N5 and a molecular weight of 430.38 g/mol. Its IUPAC name is N-piperidin-4-yl-1-(quinolin-2-ylmethyl)benzimidazol-2-amine;dihydrochloride.
| Compound Name | N-piperidin-4-yl-1-(quinolin-2-ylmethyl)benzimidazol-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 22036977 |
| Molecular Formula | C22H25Cl2N5 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-piperidin-4-yl-1-(quinolin-2-ylmethyl)benzimidazol-2-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2nc(Cn3c(NC4CCNCC4)nc4ccccc43)ccc2c1 |
| InChI | InChI=1S/C22H23N5.2ClH/c1-2-6-19-16(5-1)9-10-18(24-19)15-27-21-8-4-3-7-20(21)26-22(27)25-17-11-13-23-14-12-17;;/h1-10,17,23H,11-15H2,(H,25,26);2*1H |
| InChIKey | YTYUPAYEZWIDOX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |