C23H39FN4 — CID 143187246
1-[(E)-but-2-enyl]-N-piperidin-4-ylbenzimidazol-2-amine;ethane;3-fluoroprop-1-ene (PubChem CID 143187246) has the molecular formula C23H39FN4 and a molecular weight of 390.59 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-N-piperidin-4-ylbenzimidazol-2-amine;ethane;3-fluoroprop-1-ene.
| Compound Name | 1-[(E)-but-2-enyl]-N-piperidin-4-ylbenzimidazol-2-amine;ethane;3-fluoroprop-1-ene |
|---|---|
| PubChem CID | 143187246 |
| Molecular Formula | C23H39FN4 |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | 1-[(E)-but-2-enyl]-N-piperidin-4-ylbenzimidazol-2-amine;ethane;3-fluoroprop-1-ene |
| SMILES | C/C=C/Cn1c(NC2CCNCC2)nc2ccccc21.C=CCF.CC.CC |
| InChI | InChI=1S/C16H22N4.C3H5F.2C2H6/c1-2-3-12-20-15-7-5-4-6-14(15)19-16(20)18-13-8-10-17-11-9-13;1-2-3-4;2*1-2/h2-7,13,17H,8-12H2,1H3,(H,18,19);2H,1,3H2;2*1-2H3/b3-2+;;; |
| InChIKey | CXPONJXXVGKULF-HZBIHQSRSA-N |
| XLogP | 5.97 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|