C13H17N3OS — CID 117159877
2-[3-(thian-2-yl)imidazo[4,5-b]pyridin-2-yl]ethanol (PubChem CID 117159877) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-[3-(thian-2-yl)imidazo[4,5-b]pyridin-2-yl]ethanol.
| Compound Name | 2-[3-(thian-2-yl)imidazo[4,5-b]pyridin-2-yl]ethanol |
|---|---|
| PubChem CID | 117159877 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[3-(thian-2-yl)imidazo[4,5-b]pyridin-2-yl]ethanol |
| SMILES | OCCc1nc2cccnc2n1C1CCCCS1 |
| InChI | InChI=1S/C13H17N3OS/c17-8-6-11-15-10-4-3-7-14-13(10)16(11)12-5-1-2-9-18-12/h3-4,7,12,17H,1-2,5-6,8-9H2 |
| InChIKey | RFTRNOMNVVVLGI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |