C14H14N4O — CID 117164775
3-(2-methoxyethyl)-2-pyridin-2-ylimidazo[4,5-b]pyridine (PubChem CID 117164775) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-2-pyridin-2-ylimidazo[4,5-b]pyridine.
| Compound Name | 3-(2-methoxyethyl)-2-pyridin-2-ylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117164775 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(2-methoxyethyl)-2-pyridin-2-ylimidazo[4,5-b]pyridine |
| SMILES | COCCn1c(-c2ccccn2)nc2cccnc21 |
| InChI | InChI=1S/C14H14N4O/c1-19-10-9-18-13-12(6-4-8-16-13)17-14(18)11-5-2-3-7-15-11/h2-8H,9-10H2,1H3 |
| InChIKey | OIVWMLORSOGCGF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |