C14H8N4O3S — CID 11716580
6-(7-methyl-2-oxochromen-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-one (PubChem CID 11716580) has the molecular formula C14H8N4O3S and a molecular weight of 312.31 g/mol. Its IUPAC name is 6-(7-methyl-2-oxochromen-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-one.
| Compound Name | 6-(7-methyl-2-oxochromen-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-one |
|---|---|
| PubChem CID | 11716580 |
| Molecular Formula | C14H8N4O3S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 6-(7-methyl-2-oxochromen-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-one |
| SMILES | Cc1ccc2c(-c3nn4cnnc4sc3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C14H8N4O3S/c1-7-2-3-8-9(5-11(19)21-10(8)4-7)12-13(20)22-14-16-15-6-18(14)17-12/h2-6H,1H3 |
| InChIKey | ATCDFIPXNOIZNQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|