C18H21FN2O2 — CID 11716670
ethyl N-[4-[(3-fluoroanilino)methyl]-2,6-dimethylphenyl]carbamate (PubChem CID 11716670) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is ethyl N-[4-[(3-fluoroanilino)methyl]-2,6-dimethylphenyl]carbamate.
| Compound Name | ethyl N-[4-[(3-fluoroanilino)methyl]-2,6-dimethylphenyl]carbamate |
|---|---|
| PubChem CID | 11716670 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | ethyl N-[4-[(3-fluoroanilino)methyl]-2,6-dimethylphenyl]carbamate |
| SMILES | CCOC(=O)Nc1c(C)cc(CNc2cccc(F)c2)cc1C |
| InChI | InChI=1S/C18H21FN2O2/c1-4-23-18(22)21-17-12(2)8-14(9-13(17)3)11-20-16-7-5-6-15(19)10-16/h5-10,20H,4,11H2,1-3H3,(H,21,22) |
| InChIKey | QEYNFGCIULPLPC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |