C10H10FN3O — CID 117167840
1-[5-(4-fluorophenyl)-2H-triazol-4-yl]ethanol (PubChem CID 117167840) has the molecular formula C10H10FN3O and a molecular weight of 207.21 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)-2H-triazol-4-yl]ethanol.
| Compound Name | 1-[5-(4-fluorophenyl)-2H-triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 117167840 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-[5-(4-fluorophenyl)-2H-triazol-4-yl]ethanol |
| SMILES | CC(O)c1n[nH]nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FN3O/c1-6(15)9-10(13-14-12-9)7-2-4-8(11)5-3-7/h2-6,15H,1H3,(H,12,13,14) |
| InChIKey | XCIRZVWEFWDQNG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |