C10H16O4S — CID 117168375
methyl 2-[2-(thiolan-3-yl)-1,3-dioxolan-4-yl]acetate (PubChem CID 117168375) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is methyl 2-[2-(thiolan-3-yl)-1,3-dioxolan-4-yl]acetate.
| Compound Name | methyl 2-[2-(thiolan-3-yl)-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 117168375 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | methyl 2-[2-(thiolan-3-yl)-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)CC1COC(C2CCSC2)O1 |
| InChI | InChI=1S/C10H16O4S/c1-12-9(11)4-8-5-13-10(14-8)7-2-3-15-6-7/h7-8,10H,2-6H2,1H3 |
| InChIKey | JNWOJOHQUQJBFQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |