C11H18O4S — CID 117168473
methyl 2-[2-(thian-4-yl)-1,3-dioxolan-4-yl]acetate (PubChem CID 117168473) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is methyl 2-[2-(thian-4-yl)-1,3-dioxolan-4-yl]acetate.
| Compound Name | methyl 2-[2-(thian-4-yl)-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 117168473 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | methyl 2-[2-(thian-4-yl)-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)CC1COC(C2CCSCC2)O1 |
| InChI | InChI=1S/C11H18O4S/c1-13-10(12)6-9-7-14-11(15-9)8-2-4-16-5-3-8/h8-9,11H,2-7H2,1H3 |
| InChIKey | PNSQUDXEBIJWNJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |