C10H16O6S — CID 117168468
2-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]acetic acid (PubChem CID 117168468) has the molecular formula C10H16O6S and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]acetic acid.
| Compound Name | 2-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 117168468 |
| Molecular Formula | C10H16O6S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]acetic acid |
| SMILES | O=C(O)CC1COC(C2CCS(=O)(=O)CC2)O1 |
| InChI | InChI=1S/C10H16O6S/c11-9(12)5-8-6-15-10(16-8)7-1-3-17(13,14)4-2-7/h7-8,10H,1-6H2,(H,11,12) |
| InChIKey | KCFMLWCKBDZQNF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |