C10H18O5S — CID 117168441
2-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]ethanol (PubChem CID 117168441) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 117168441 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]ethanol |
| SMILES | O=S1(=O)CCC(C2OCC(CCO)O2)CC1 |
| InChI | InChI=1S/C10H18O5S/c11-4-1-9-7-14-10(15-9)8-2-5-16(12,13)6-3-8/h8-11H,1-7H2 |
| InChIKey | ZBRFVDZSJWUCBE-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |