C9H16O5S — CID 117168343
2-[2-(1,1-dioxothiolan-3-yl)-1,3-dioxolan-4-yl]ethanol (PubChem CID 117168343) has the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothiolan-3-yl)-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[2-(1,1-dioxothiolan-3-yl)-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 117168343 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-[2-(1,1-dioxothiolan-3-yl)-1,3-dioxolan-4-yl]ethanol |
| SMILES | O=S1(=O)CCC(C2OCC(CCO)O2)C1 |
| InChI | InChI=1S/C9H16O5S/c10-3-1-8-5-13-9(14-8)7-2-4-15(11,12)6-7/h7-10H,1-6H2 |
| InChIKey | VGCLSKAXERDXGN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |