About [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol
[2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol (PubChem CID 115094509) has the molecular formula C8H14O5S
and a molecular weight of 222.26 g/mol. Its IUPAC name is [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol.
Analyze [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol (CID 115094509) is [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol is O=S1(=O)CCCC1C1OCC(CO)O1.
What is the InChIKey of [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol?
The InChIKey is HAVKLTSPKOUJBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5S/c9-4-6-5-12-8(13-6)7-2-1-3-14(7,10)11/h6-9H,1-5H2.
What are the key properties of [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol?
[2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol has a molecular weight of 222.26 g/mol, XLogP of -0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,1-dioxothiolan-2-yl)-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 115094509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).