C11H20O10S2 — CID 11696489
[(2S,3R,4R,5S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4-hydroxy-5-methoxyoxolan-3-yl] sulfate (PubChem CID 11696489) has the molecular formula C11H20O10S2 and a molecular weight of 376.41 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4-hydroxy-5-methoxyoxolan-3-yl] sulfate.
| Compound Name | [(2S,3R,4R,5S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4-hydroxy-5-methoxyoxolan-3-yl] sulfate |
|---|---|
| PubChem CID | 11696489 |
| Molecular Formula | C11H20O10S2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [(2S,3R,4R,5S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4-hydroxy-5-methoxyoxolan-3-yl] sulfate |
| SMILES | CO[C@H]1O[C@H](C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)[C@H](OS(=O)(=O)[O-])[C@H]1O |
| InChI | InChI=1S/C11H20O10S2/c1-19-11-9(15)10(21-23(16,17)18)6(20-11)4-22-3-5(13)8(14)7(22)2-12/h5-15H,2-4H2,1H3/t5-,6-,7-,8+,9-,10+,11+,22?/m1/s1 |
| InChIKey | PPOQOTUOBSZWKS-NSHVNVEMSA-N |
| XLogP | -3.72 |
| TPSA | 165.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|