C9H18O4S — CID 86574823
(3S,4S,5R)-2-butylsulfanyl-5-methoxyoxolane-3,4-diol (PubChem CID 86574823) has the molecular formula C9H18O4S and a molecular weight of 222.31 g/mol. Its IUPAC name is (3S,4S,5R)-2-butylsulfanyl-5-methoxyoxolane-3,4-diol.
| Compound Name | (3S,4S,5R)-2-butylsulfanyl-5-methoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 86574823 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (3S,4S,5R)-2-butylsulfanyl-5-methoxyoxolane-3,4-diol |
| SMILES | CCCCSC1O[C@@H](OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H18O4S/c1-3-4-5-14-9-7(11)6(10)8(12-2)13-9/h6-11H,3-5H2,1-2H3/t6-,7-,8+,9?/m0/s1 |
| InChIKey | GIYOQOACWQRDIR-VTBDLZGYSA-N |
| XLogP | 0.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|