C10H18O10S2 — CID 11639124
[(2S,3R,4R,5S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5-dihydroxyoxolan-3-yl] sulfate (PubChem CID 11639124) has the molecular formula C10H18O10S2 and a molecular weight of 362.38 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5-dihydroxyoxolan-3-yl] sulfate.
| Compound Name | [(2S,3R,4R,5S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5-dihydroxyoxolan-3-yl] sulfate |
|---|---|
| PubChem CID | 11639124 |
| Molecular Formula | C10H18O10S2 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [(2S,3R,4R,5S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5-dihydroxyoxolan-3-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@@H]1[C@@H](O)[C@@H](O)O[C@@H]1C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C10H18O10S2/c11-1-6-7(13)4(12)2-21(6)3-5-9(20-22(16,17)18)8(14)10(15)19-5/h4-15H,1-3H2/t4-,5-,6-,7+,8-,9+,10+,21?/m1/s1 |
| InChIKey | SLUWTRQQVVGPBE-ZSZYPNSDSA-N |
| XLogP | -4.38 |
| TPSA | 176.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|