C10H18O10S2 — CID 58747922
(2R,3S,4R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5-dihydroxyoxolane-3-sulfonoperoxoate (PubChem CID 58747922) has the molecular formula C10H18O10S2 and a molecular weight of 362.38 g/mol. Its IUPAC name is (2R,3S,4R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5-dihydroxyoxolane-3-sulfonoperoxoate.
| Compound Name | (2R,3S,4R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5-dihydroxyoxolane-3-sulfonoperoxoate |
|---|---|
| PubChem CID | 58747922 |
| Molecular Formula | C10H18O10S2 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (2R,3S,4R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5-dihydroxyoxolane-3-sulfonoperoxoate |
| SMILES | O=S(=O)(O[O-])[C@H]1[C@H](O)C(O)O[C@@H]1C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C10H18O10S2/c11-1-6-7(13)4(12)2-21(6)3-5-9(22(17,18)20-16)8(14)10(15)19-5/h4-15H,1-3H2/t4-,5-,6-,7+,8+,9-,10?,21?/m1/s1 |
| InChIKey | YITSYHMTGFUQOT-UIRLMUCVSA-N |
| XLogP | -5.23 |
| TPSA | 176.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -5.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|