C11H20O11S2 — CID 58747849
(2R,3R,4R,5R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-trihydroxyoxane-3-sulfonoperoxoate (PubChem CID 58747849) has the molecular formula C11H20O11S2 and a molecular weight of 392.40 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-trihydroxyoxane-3-sulfonoperoxoate.
| Compound Name | (2R,3R,4R,5R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-trihydroxyoxane-3-sulfonoperoxoate |
|---|---|
| PubChem CID | 58747849 |
| Molecular Formula | C11H20O11S2 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | (2R,3R,4R,5R)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-trihydroxyoxane-3-sulfonoperoxoate |
| SMILES | O=S(=O)(O[O-])[C@@H]1[C@H](O)[C@@H](O)C(O)O[C@@H]1C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C11H20O11S2/c12-1-6-7(14)4(13)2-23(6)3-5-10(24(19,20)22-18)8(15)9(16)11(17)21-5/h4-17H,1-3H2/t4-,5-,6-,7+,8-,9-,10+,11?,23?/m1/s1 |
| InChIKey | CVYNDGZNJRKGGA-QUDFYWQPSA-N |
| XLogP | -5.87 |
| TPSA | 197.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | -5.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|